C11H12BrF4NO2 — CID 103482862
5-bromo-4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propoxy]aniline (PubChem CID 103482862) has the molecular formula C11H12BrF4NO2 and a molecular weight of 346.12 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propoxy]aniline.
| Compound Name | 5-bromo-4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propoxy]aniline |
|---|---|
| PubChem CID | 103482862 |
| Molecular Formula | C11H12BrF4NO2 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 5-bromo-4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propoxy]aniline |
| SMILES | Nc1cc(Br)c(F)cc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H12BrF4NO2/c12-7-4-9(17)10(5-8(7)13)19-3-1-2-18-6-11(14,15)16/h4-5H,1-3,6,17H2 |
| InChIKey | COYDNHSIRHHYNB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|