C8H4Br2F4O — CID 169337045
1,4-dibromo-2-fluoro-5-(2,2,2-trifluoroethoxy)benzene (PubChem CID 169337045) has the molecular formula C8H4Br2F4O and a molecular weight of 351.92 g/mol. Its IUPAC name is 1,4-dibromo-2-fluoro-5-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1,4-dibromo-2-fluoro-5-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 169337045 |
| Molecular Formula | C8H4Br2F4O |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 349.86 |
| IUPAC Name | 1,4-dibromo-2-fluoro-5-(2,2,2-trifluoroethoxy)benzene |
| SMILES | Fc1cc(Br)c(OCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C8H4Br2F4O/c9-4-2-7(5(10)1-6(4)11)15-3-8(12,13)14/h1-2H,3H2 |
| InChIKey | LTAHTYMVCPKOED-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|