C10H9BrF5NO — CID 103843080
4-bromo-2,5-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline (PubChem CID 103843080) has the molecular formula C10H9BrF5NO and a molecular weight of 334.08 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline.
| Compound Name | 4-bromo-2,5-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
|---|---|
| PubChem CID | 103843080 |
| Molecular Formula | C10H9BrF5NO |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-bromo-2,5-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
| SMILES | Fc1cc(NCCOCC(F)(F)F)c(F)cc1Br |
| InChI | InChI=1S/C10H9BrF5NO/c11-6-3-8(13)9(4-7(6)12)17-1-2-18-5-10(14,15)16/h3-4,17H,1-2,5H2 |
| InChIKey | YTEHHZAIYMSHGG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|