C12H13BrF5NO — CID 103207615
1-(4-bromo-2,5-difluorophenyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103207615) has the molecular formula C12H13BrF5NO and a molecular weight of 362.14 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103207615 |
| Molecular Formula | C12H13BrF5NO |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CNC(CCOCC(F)(F)F)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H13BrF5NO/c1-19-11(2-3-20-6-12(16,17)18)7-4-10(15)8(13)5-9(7)14/h4-5,11,19H,2-3,6H2,1H3 |
| InChIKey | WYZOERJYOJGZDG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|