C11H8BrF8N — CID 103309676
1-(4-bromo-2,5-difluorophenyl)-3,3,3-trifluoro-N-methyl-2-(trifluoromethyl)propan-1-amine (PubChem CID 103309676) has the molecular formula C11H8BrF8N and a molecular weight of 386.08 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-3,3,3-trifluoro-N-methyl-2-(trifluoromethyl)propan-1-amine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-3,3,3-trifluoro-N-methyl-2-(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 103309676 |
| Molecular Formula | C11H8BrF8N |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-3,3,3-trifluoro-N-methyl-2-(trifluoromethyl)propan-1-amine |
| SMILES | CNC(c1cc(F)c(Br)cc1F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8BrF8N/c1-21-8(9(10(15,16)17)11(18,19)20)4-2-7(14)5(12)3-6(4)13/h2-3,8-9,21H,1H3 |
| InChIKey | FOUBZDYQZDEEKK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|