C12H12BrF6N — CID 79660900
1-(4-bromo-2,5-difluorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine (PubChem CID 79660900) has the molecular formula C12H12BrF6N and a molecular weight of 364.13 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79660900 |
| Molecular Formula | C12H12BrF6N |
| Molecular Weight | 364.13 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(F)c(Br)cc1F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H12BrF6N/c1-2-3-20-10(12(18,19)11(16)17)6-4-9(15)7(13)5-8(6)14/h4-5,10-11,20H,2-3H2,1H3 |
| InChIKey | YSYPBMSNHLXDRV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.13 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|