C14H18BrF4NO — CID 79644821
1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine (PubChem CID 79644821) has the molecular formula C14H18BrF4NO and a molecular weight of 372.20 g/mol. Its IUPAC name is 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79644821 |
| Molecular Formula | C14H18BrF4NO |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(Br)ccc1OCC)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H18BrF4NO/c1-3-7-20-12(14(18,19)13(16)17)10-8-9(15)5-6-11(10)21-4-2/h5-6,8,12-13,20H,3-4,7H2,1-2H3 |
| InChIKey | QWIAZPLHEADGMO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|