C11H11BrF4O2 — CID 79660455
1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 79660455) has the molecular formula C11H11BrF4O2 and a molecular weight of 331.10 g/mol. Its IUPAC name is 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 79660455 |
| Molecular Formula | C11H11BrF4O2 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-(5-bromo-2-ethoxyphenyl)-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | CCOc1ccc(Br)cc1C(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H11BrF4O2/c1-2-18-8-4-3-6(12)5-7(8)9(17)11(15,16)10(13)14/h3-5,9-10,17H,2H2,1H3 |
| InChIKey | OZKGRDZVBQQXQN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|