C12H15BrF3NO — CID 171226083
(1S)-1-(5-bromo-2-ethoxyphenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171226083) has the molecular formula C12H15BrF3NO and a molecular weight of 326.16 g/mol. Its IUPAC name is (1S)-1-(5-bromo-2-ethoxyphenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1S)-1-(5-bromo-2-ethoxyphenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171226083 |
| Molecular Formula | C12H15BrF3NO |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (1S)-1-(5-bromo-2-ethoxyphenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCOc1ccc(Br)cc1[C@@H](N)CCC(F)(F)F |
| InChI | InChI=1S/C12H15BrF3NO/c1-2-18-11-4-3-8(13)7-9(11)10(17)5-6-12(14,15)16/h3-4,7,10H,2,5-6,17H2,1H3/t10-/m0/s1 |
| InChIKey | ATDIYOULNQTBTQ-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |