C17H28BrNO — CID 43311377
1-(5-bromo-2-ethoxyphenyl)-3,5,5-trimethylhexan-1-amine (PubChem CID 43311377) has the molecular formula C17H28BrNO and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-(5-bromo-2-ethoxyphenyl)-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(5-bromo-2-ethoxyphenyl)-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 43311377 |
| Molecular Formula | C17H28BrNO |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(5-bromo-2-ethoxyphenyl)-3,5,5-trimethylhexan-1-amine |
| SMILES | CCOc1ccc(Br)cc1C(N)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H28BrNO/c1-6-20-16-8-7-13(18)10-14(16)15(19)9-12(2)11-17(3,4)5/h7-8,10,12,15H,6,9,11,19H2,1-5H3 |
| InChIKey | PENNSCGRBHCNTL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |