C16H24BrNO3 — CID 62942372
ethyl 5-amino-5-(5-bromo-2-ethoxyphenyl)-3-methylpentanoate (PubChem CID 62942372) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is ethyl 5-amino-5-(5-bromo-2-ethoxyphenyl)-3-methylpentanoate.
| Compound Name | ethyl 5-amino-5-(5-bromo-2-ethoxyphenyl)-3-methylpentanoate |
|---|---|
| PubChem CID | 62942372 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | ethyl 5-amino-5-(5-bromo-2-ethoxyphenyl)-3-methylpentanoate |
| SMILES | CCOC(=O)CC(C)CC(N)c1cc(Br)ccc1OCC |
| InChI | InChI=1S/C16H24BrNO3/c1-4-20-15-7-6-12(17)10-13(15)14(18)8-11(3)9-16(19)21-5-2/h6-7,10-11,14H,4-5,8-9,18H2,1-3H3 |
| InChIKey | CWHVGRDPKVQAIF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |