C13H18BrNO4 — CID 61327800
ethyl 2-[2-amino-2-(5-bromo-2-methoxyphenyl)ethoxy]acetate (PubChem CID 61327800) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is ethyl 2-[2-amino-2-(5-bromo-2-methoxyphenyl)ethoxy]acetate.
| Compound Name | ethyl 2-[2-amino-2-(5-bromo-2-methoxyphenyl)ethoxy]acetate |
|---|---|
| PubChem CID | 61327800 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | ethyl 2-[2-amino-2-(5-bromo-2-methoxyphenyl)ethoxy]acetate |
| SMILES | CCOC(=O)COCC(N)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H18BrNO4/c1-3-19-13(16)8-18-7-11(15)10-6-9(14)4-5-12(10)17-2/h4-6,11H,3,7-8,15H2,1-2H3 |
| InChIKey | UTPKOTFKOKJFHR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |