C12H15BrO4 — CID 102076818
ethyl (2S)-2-(5-bromo-2-methoxyphenyl)-3-hydroxypropanoate (PubChem CID 102076818) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is ethyl (2S)-2-(5-bromo-2-methoxyphenyl)-3-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-(5-bromo-2-methoxyphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 102076818 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | ethyl (2S)-2-(5-bromo-2-methoxyphenyl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](CO)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C12H15BrO4/c1-3-17-12(15)10(7-14)9-6-8(13)4-5-11(9)16-2/h4-6,10,14H,3,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | RNJDCUNNWYEATQ-SNVBAGLBSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |