C13H16BrNO5 — CID 66204297
ethyl 3-(5-bromo-2-methoxyphenyl)-2-formamido-3-hydroxypropanoate (PubChem CID 66204297) has the molecular formula C13H16BrNO5 and a molecular weight of 346.18 g/mol. Its IUPAC name is ethyl 3-(5-bromo-2-methoxyphenyl)-2-formamido-3-hydroxypropanoate.
| Compound Name | ethyl 3-(5-bromo-2-methoxyphenyl)-2-formamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 66204297 |
| Molecular Formula | C13H16BrNO5 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | ethyl 3-(5-bromo-2-methoxyphenyl)-2-formamido-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(NC=O)C(O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H16BrNO5/c1-3-20-13(18)11(15-7-16)12(17)9-6-8(14)4-5-10(9)19-2/h4-7,11-12,17H,3H2,1-2H3,(H,15,16) |
| InChIKey | NGQAGCZMUZNDKS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|