C19H26BrNO7 — CID 101435300
diethyl 2-[2-(5-bromo-2-methoxyphenyl)-3-(methoxycarbonylamino)propyl]propanedioate (PubChem CID 101435300) has the molecular formula C19H26BrNO7 and a molecular weight of 460.32 g/mol. Its IUPAC name is diethyl 2-[2-(5-bromo-2-methoxyphenyl)-3-(methoxycarbonylamino)propyl]propanedioate.
| Compound Name | diethyl 2-[2-(5-bromo-2-methoxyphenyl)-3-(methoxycarbonylamino)propyl]propanedioate |
|---|---|
| PubChem CID | 101435300 |
| Molecular Formula | C19H26BrNO7 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | diethyl 2-[2-(5-bromo-2-methoxyphenyl)-3-(methoxycarbonylamino)propyl]propanedioate |
| SMILES | CCOC(=O)C(CC(CNC(=O)OC)c1cc(Br)ccc1OC)C(=O)OCC |
| InChI | InChI=1S/C19H26BrNO7/c1-5-27-17(22)15(18(23)28-6-2)9-12(11-21-19(24)26-4)14-10-13(20)7-8-16(14)25-3/h7-8,10,12,15H,5-6,9,11H2,1-4H3,(H,21,24) |
| InChIKey | XJWAKKLRNZGWST-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|