C10H12BrNO3 — CID 110780679
methyl N-[(5-bromo-2-methoxyphenyl)methyl]carbamate (PubChem CID 110780679) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is methyl N-[(5-bromo-2-methoxyphenyl)methyl]carbamate.
| Compound Name | methyl N-[(5-bromo-2-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 110780679 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | methyl N-[(5-bromo-2-methoxyphenyl)methyl]carbamate |
| SMILES | COC(=O)NCc1cc(Br)ccc1OC |
| InChI | InChI=1S/C10H12BrNO3/c1-14-9-4-3-8(11)5-7(9)6-12-10(13)15-2/h3-5H,6H2,1-2H3,(H,12,13) |
| InChIKey | BDYLOCDLLHXTCI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |