C12H14BrNO4 — CID 115163690
4-[(5-bromo-2-methoxyphenyl)methylamino]-4-oxobutanoic acid (PubChem CID 115163690) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 4-[(5-bromo-2-methoxyphenyl)methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(5-bromo-2-methoxyphenyl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115163690 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 4-[(5-bromo-2-methoxyphenyl)methylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(Br)cc1CNC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H14BrNO4/c1-18-10-3-2-9(13)6-8(10)7-14-11(15)4-5-12(16)17/h2-3,6H,4-5,7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | SOAHZWANXBIJRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |