C13H16ClNO5 — CID 54785552
4-[(2-chloro-4,5-dimethoxyphenyl)methylamino]-4-oxobutanoic acid (PubChem CID 54785552) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is 4-[(2-chloro-4,5-dimethoxyphenyl)methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2-chloro-4,5-dimethoxyphenyl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54785552 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[(2-chloro-4,5-dimethoxyphenyl)methylamino]-4-oxobutanoic acid |
| SMILES | COc1cc(Cl)c(CNC(=O)CCC(=O)O)cc1OC |
| InChI | InChI=1S/C13H16ClNO5/c1-19-10-5-8(9(14)6-11(10)20-2)7-15-12(16)3-4-13(17)18/h5-6H,3-4,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BOCYUPRFIJYUDE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |