C13H18BrNO4 — CID 113385120
3-bromo-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 113385120) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-bromo-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-bromo-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 113385120 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-bromo-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)CCBr |
| InChI | InChI=1S/C13H18BrNO4/c1-17-10-7-12(19-3)11(18-2)6-9(10)8-15-13(16)4-5-14/h6-7H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | NWSXPGDEVRKQPL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|