C18H30N2O4 — CID 34600439
2-(dipropylamino)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 34600439) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(dipropylamino)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(dipropylamino)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 34600439 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-(dipropylamino)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | CCCN(CCC)CC(=O)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C18H30N2O4/c1-6-8-20(9-7-2)13-18(21)19-12-14-10-16(23-4)17(24-5)11-15(14)22-3/h10-11H,6-9,12-13H2,1-5H3,(H,19,21) |
| InChIKey | ZPFVCHOBYFAUTG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |