C20H32N2O4 — CID 34620482
2-[cyclohexyl(ethyl)amino]-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 34620482) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[cyclohexyl(ethyl)amino]-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[cyclohexyl(ethyl)amino]-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 34620482 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[cyclohexyl(ethyl)amino]-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1cc(OC)c(OC)cc1OC)C1CCCCC1 |
| InChI | InChI=1S/C20H32N2O4/c1-5-22(16-9-7-6-8-10-16)14-20(23)21-13-15-11-18(25-3)19(26-4)12-17(15)24-2/h11-12,16H,5-10,13-14H2,1-4H3,(H,21,23) |
| InChIKey | QWNVACPSNGBQBW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |