C12H15F2NO4 — CID 103602966
2,2-difluoro-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 103602966) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 103602966 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2,2-difluoro-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)C(F)F |
| InChI | InChI=1S/C12H15F2NO4/c1-17-8-5-10(19-3)9(18-2)4-7(8)6-15-12(16)11(13)14/h4-5,11H,6H2,1-3H3,(H,15,16) |
| InChIKey | TYIRMRMFFMIUJX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |