C18H19F2NO6S — CID 8511792
4-(difluoromethylsulfonyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 8511792) has the molecular formula C18H19F2NO6S and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 8511792 |
| Molecular Formula | C18H19F2NO6S |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C18H19F2NO6S/c1-25-14-9-16(27-3)15(26-2)8-12(14)10-21-17(22)11-4-6-13(7-5-11)28(23,24)18(19)20/h4-9,18H,10H2,1-3H3,(H,21,22) |
| InChIKey | RAKKDCKXWUQHGB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |