C18H19F2NO4S — CID 9050026
4-(difluoromethylsulfonyl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide (PubChem CID 9050026) has the molecular formula C18H19F2NO4S and a molecular weight of 383.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 9050026 |
| Molecular Formula | C18H19F2NO4S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C18H19F2NO4S/c1-12-3-8-16(25-2)14(11-12)9-10-21-17(22)13-4-6-15(7-5-13)26(23,24)18(19)20/h3-8,11,18H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | VHQFWEDRZBIZMR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |