C20H26N2O5S — CID 55396010
3-(dimethylsulfamoyl)-4-methoxy-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide (PubChem CID 55396010) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55396010 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H26N2O5S/c1-14-6-8-17(26-4)15(12-14)10-11-21-20(23)16-7-9-18(27-5)19(13-16)28(24,25)22(2)3/h6-9,12-13H,10-11H2,1-5H3,(H,21,23) |
| InChIKey | MBSLGLIFDIEMAR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |