C16H12F5NO3S — CID 25402418
4-(difluoromethylsulfonyl)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 25402418) has the molecular formula C16H12F5NO3S and a molecular weight of 393.33 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 25402418 |
| Molecular Formula | C16H12F5NO3S |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H12F5NO3S/c17-15(18)26(24,25)13-7-3-11(4-8-13)14(23)22-9-10-1-5-12(6-2-10)16(19,20)21/h1-8,15H,9H2,(H,22,23) |
| InChIKey | SSEKJYPHAKJQAS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |