C17H15F3N6O3S — CID 25073174
4-[(2-methyltetrazol-5-yl)sulfamoyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 25073174) has the molecular formula C17H15F3N6O3S and a molecular weight of 440.41 g/mol. Its IUPAC name is 4-[(2-methyltetrazol-5-yl)sulfamoyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[(2-methyltetrazol-5-yl)sulfamoyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 25073174 |
| Molecular Formula | C17H15F3N6O3S |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-[(2-methyltetrazol-5-yl)sulfamoyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | Cn1nnc(NS(=O)(=O)c2ccc(C(=O)NCc3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C17H15F3N6O3S/c1-26-23-16(22-25-26)24-30(28,29)14-8-4-12(5-9-14)15(27)21-10-11-2-6-13(7-3-11)17(18,19)20/h2-9H,10H2,1H3,(H,21,27)(H,23,24) |
| InChIKey | CMRQZHLWBAIWLV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |