C26H28N2O6 — CID 46542093
1-N,4-N-bis[(2,5-dimethoxyphenyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 46542093) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-N,4-N-bis[(2,5-dimethoxyphenyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2,5-dimethoxyphenyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 46542093 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-N,4-N-bis[(2,5-dimethoxyphenyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(OC)c(CNC(=O)c2ccc(C(=O)NCc3cc(OC)ccc3OC)cc2)c1 |
| InChI | InChI=1S/C26H28N2O6/c1-31-21-9-11-23(33-3)19(13-21)15-27-25(29)17-5-7-18(8-6-17)26(30)28-16-20-14-22(32-2)10-12-24(20)34-4/h5-14H,15-16H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | YBUDWUSMPDTMMU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |