C23H23N3O4 — CID 33104762
N-[(2,5-dimethoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 33104762) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 33104762 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | COc1ccc(OC)c(CNC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-20-12-13-21(30-2)17(14-20)15-24-22(27)16-8-10-19(11-9-16)26-23(28)25-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3,(H,24,27)(H2,25,26,28) |
| InChIKey | OPFFDBWRCAPKNQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |