C21H20N2O4S — CID 33102267
N-[3-[(2,5-dimethoxyphenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 33102267) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[3-[(2,5-dimethoxyphenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(2,5-dimethoxyphenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33102267 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-[(2,5-dimethoxyphenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(OC)c(CNC(=O)c2cccc(NC(=O)c3cccs3)c2)c1 |
| InChI | InChI=1S/C21H20N2O4S/c1-26-17-8-9-18(27-2)15(12-17)13-22-20(24)14-5-3-6-16(11-14)23-21(25)19-7-4-10-28-19/h3-12H,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | XXIAYLVFLKZFRH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |