C18H19BrN2O4 — CID 33108134
4-bromo-N-[2-[(2,5-dimethoxyphenyl)methylamino]-2-oxoethyl]benzamide (PubChem CID 33108134) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is 4-bromo-N-[2-[(2,5-dimethoxyphenyl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(2,5-dimethoxyphenyl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 33108134 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 4-bromo-N-[2-[(2,5-dimethoxyphenyl)methylamino]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(OC)c(CNC(=O)CNC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C18H19BrN2O4/c1-24-15-7-8-16(25-2)13(9-15)10-20-17(22)11-21-18(23)12-3-5-14(19)6-4-12/h3-9H,10-11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | CDNFQGPQFLYNGW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |