C14H20N2O4 — CID 78823018
2-(2,5-dimethoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide (PubChem CID 78823018) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 78823018 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide |
| SMILES | CCNC(=O)CNC(=O)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-4-15-14(18)9-16-13(17)8-10-7-11(19-2)5-6-12(10)20-3/h5-7H,4,8-9H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | ICPBPFPQNJOMEG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |