C11H15NO4 — CID 78829398
2-(2,5-dimethoxyphenyl)-N-methoxyacetamide (PubChem CID 78829398) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-methoxyacetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-methoxyacetamide |
|---|---|
| PubChem CID | 78829398 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-methoxyacetamide |
| SMILES | CONC(=O)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H15NO4/c1-14-9-4-5-10(15-2)8(6-9)7-11(13)12-16-3/h4-6H,7H2,1-3H3,(H,12,13) |
| InChIKey | DBEUQMKFHVXFAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|