C11H14O3S — CID 58139295
1-(2,5-dimethoxyphenyl)-3-sulfanylpropan-2-one (PubChem CID 58139295) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-sulfanylpropan-2-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-sulfanylpropan-2-one |
|---|---|
| PubChem CID | 58139295 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-sulfanylpropan-2-one |
| SMILES | COc1ccc(OC)c(CC(=O)CS)c1 |
| InChI | InChI=1S/C11H14O3S/c1-13-10-3-4-11(14-2)8(6-10)5-9(12)7-15/h3-4,6,15H,5,7H2,1-2H3 |
| InChIKey | SOEHOUXOHSQWHQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|