C11H15NO4 — CID 175601601
2-(2,5-dimethoxyphenyl)ethyl carbamate (PubChem CID 175601601) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)ethyl carbamate.
| Compound Name | 2-(2,5-dimethoxyphenyl)ethyl carbamate |
|---|---|
| PubChem CID | 175601601 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)ethyl carbamate |
| SMILES | COc1ccc(OC)c(CCOC(N)=O)c1 |
| InChI | InChI=1S/C11H15NO4/c1-14-9-3-4-10(15-2)8(7-9)5-6-16-11(12)13/h3-4,7H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | PXQPXZCCMGFIIO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |