3-(2,5-dimethoxyphenyl)propanoyl chloride

C11H13ClO3 — CID 121219721

IUPAC3-(2,5-dimethoxyphenyl)propanoyl chloride
SMILESCOc1ccc(OC)c(CCC(=O)Cl)c1
InChIInChI=1S/C11H13ClO3/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h4-5,7H,3,6H2,1-2H3
InChIKeyXDQIRTSKIHVAPM-UHFFFAOYSA-N
MW228.67 g/mol
LogP2.40
Rot. Bonds5

About 3-(2,5-dimethoxyphenyl)propanoyl chloride

3-(2,5-dimethoxyphenyl)propanoyl chloride (PubChem CID 121219721) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)propanoyl chloride.

Molecular Properties

Compound Name3-(2,5-dimethoxyphenyl)propanoyl chloride
PubChem CID121219721
Molecular FormulaC11H13ClO3
Molecular Weight228.67 g/mol
Exact Mass228.06
IUPAC Name3-(2,5-dimethoxyphenyl)propanoyl chloride
SMILESCOc1ccc(OC)c(CCC(=O)Cl)c1
InChIInChI=1S/C11H13ClO3/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h4-5,7H,3,6H2,1-2H3
InChIKeyXDQIRTSKIHVAPM-UHFFFAOYSA-N
XLogP2.40
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.67
LogP ≤ 52.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-(2,5-dimethoxyphenyl)propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dimethoxyphenyl)propanoyl chloride?
The IUPAC name of 3-(2,5-dimethoxyphenyl)propanoyl chloride (CID 121219721) is 3-(2,5-dimethoxyphenyl)propanoyl chloride.
What is the SMILES notation for 3-(2,5-dimethoxyphenyl)propanoyl chloride?
The canonical SMILES for 3-(2,5-dimethoxyphenyl)propanoyl chloride is COc1ccc(OC)c(CCC(=O)Cl)c1.
What is the InChIKey of 3-(2,5-dimethoxyphenyl)propanoyl chloride?
The InChIKey is XDQIRTSKIHVAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h4-5,7H,3,6H2,1-2H3.
What are the key properties of 3-(2,5-dimethoxyphenyl)propanoyl chloride?
3-(2,5-dimethoxyphenyl)propanoyl chloride has a molecular weight of 228.67 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethoxyphenyl)propanoyl chloride is sourced from PubChem (CID 121219721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).