C12H15BrO2 — CID 24721947
2-(3-bromobut-3-enyl)-1,4-dimethoxybenzene (PubChem CID 24721947) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 2-(3-bromobut-3-enyl)-1,4-dimethoxybenzene.
| Compound Name | 2-(3-bromobut-3-enyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 24721947 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(3-bromobut-3-enyl)-1,4-dimethoxybenzene |
| SMILES | C=C(Br)CCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H15BrO2/c1-9(13)4-5-10-8-11(14-2)6-7-12(10)15-3/h6-8H,1,4-5H2,2-3H3 |
| InChIKey | RUUJVFAMPFLIFT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |