C15H20O3 — CID 102021855
(Z)-6-(2,5-dimethoxyphenyl)-4-methylhex-3-en-2-one (PubChem CID 102021855) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (Z)-6-(2,5-dimethoxyphenyl)-4-methylhex-3-en-2-one.
| Compound Name | (Z)-6-(2,5-dimethoxyphenyl)-4-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 102021855 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (Z)-6-(2,5-dimethoxyphenyl)-4-methylhex-3-en-2-one |
| SMILES | COc1ccc(OC)c(CC/C(C)=C\C(C)=O)c1 |
| InChI | InChI=1S/C15H20O3/c1-11(9-12(2)16)5-6-13-10-14(17-3)7-8-15(13)18-4/h7-10H,5-6H2,1-4H3/b11-9- |
| InChIKey | AMPYHCDKCSLEON-LUAWRHEFSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|