C11H15FO2 — CID 83938230
2-(3-fluoropropyl)-1,4-dimethoxybenzene (PubChem CID 83938230) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-(3-fluoropropyl)-1,4-dimethoxybenzene.
| Compound Name | 2-(3-fluoropropyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 83938230 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(3-fluoropropyl)-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(CCCF)c1 |
| InChI | InChI=1S/C11H15FO2/c1-13-10-5-6-11(14-2)9(8-10)4-3-7-12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | QDJQPGYJVKDAGI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |