C11H16NO4S- — CID 57145457
1,4-dimethoxy-2-[3-(sulfinatoamino)propyl]benzene (PubChem CID 57145457) has the molecular formula C11H16NO4S- and a molecular weight of 258.32 g/mol. Its IUPAC name is 1,4-dimethoxy-2-[3-(sulfinatoamino)propyl]benzene.
| Compound Name | 1,4-dimethoxy-2-[3-(sulfinatoamino)propyl]benzene |
|---|---|
| PubChem CID | 57145457 |
| Molecular Formula | C11H16NO4S- |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1,4-dimethoxy-2-[3-(sulfinatoamino)propyl]benzene |
| SMILES | COc1ccc(OC)c(CCCNS(=O)[O-])c1 |
| InChI | InChI=1S/C11H17NO4S/c1-15-10-5-6-11(16-2)9(8-10)4-3-7-12-17(13)14/h5-6,8,12H,3-4,7H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | LVTBGPWEZUZBDA-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|