C16H21N3O2 — CID 133405983
N-[3-(2,5-dimethoxyphenyl)propyl]-4-methylpyrimidin-2-amine (PubChem CID 133405983) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[3-(2,5-dimethoxyphenyl)propyl]-4-methylpyrimidin-2-amine.
| Compound Name | N-[3-(2,5-dimethoxyphenyl)propyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 133405983 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[3-(2,5-dimethoxyphenyl)propyl]-4-methylpyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(CCCNc2nccc(C)n2)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-8-10-18-16(19-12)17-9-4-5-13-11-14(20-2)6-7-15(13)21-3/h6-8,10-11H,4-5,9H2,1-3H3,(H,17,18,19) |
| InChIKey | BJJJQDVEBPYQMT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|