C8H12FN3 — CID 130504329
N-(3-fluoropropyl)-4-methylpyrimidin-2-amine (PubChem CID 130504329) has the molecular formula C8H12FN3 and a molecular weight of 169.20 g/mol. Its IUPAC name is N-(3-fluoropropyl)-4-methylpyrimidin-2-amine.
| Compound Name | N-(3-fluoropropyl)-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 130504329 |
| Molecular Formula | C8H12FN3 |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | N-(3-fluoropropyl)-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccnc(NCCCF)n1 |
| InChI | InChI=1S/C8H12FN3/c1-7-3-6-11-8(12-7)10-5-2-4-9/h3,6H,2,4-5H2,1H3,(H,10,11,12) |
| InChIKey | VTKOZGKHXAPSTK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|