C9H14FN3 — CID 130637741
N-(3-fluorobutyl)-4-methylpyrimidin-2-amine (PubChem CID 130637741) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(3-fluorobutyl)-4-methylpyrimidin-2-amine.
| Compound Name | N-(3-fluorobutyl)-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 130637741 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | N-(3-fluorobutyl)-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccnc(NCCC(C)F)n1 |
| InChI | InChI=1S/C9H14FN3/c1-7(10)3-5-11-9-12-6-4-8(2)13-9/h4,6-7H,3,5H2,1-2H3,(H,11,12,13) |
| InChIKey | FVMHKRORDMDPHZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |