C10H13N3 — CID 116644591
4-methyl-N-pent-3-ynylpyrimidin-2-amine (PubChem CID 116644591) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-methyl-N-pent-3-ynylpyrimidin-2-amine.
| Compound Name | 4-methyl-N-pent-3-ynylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116644591 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-methyl-N-pent-3-ynylpyrimidin-2-amine |
| SMILES | CC#CCCNc1nccc(C)n1 |
| InChI | InChI=1S/C10H13N3/c1-3-4-5-7-11-10-12-8-6-9(2)13-10/h6,8H,5,7H2,1-2H3,(H,11,12,13) |
| InChIKey | NNQJTILCQZEYNP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|