C10H18N4O — CID 106308364
N-[3-(2-aminoethoxy)propyl]-4-methylpyrimidin-2-amine (PubChem CID 106308364) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-4-methylpyrimidin-2-amine.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 106308364 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccnc(NCCCOCCN)n1 |
| InChI | InChI=1S/C10H18N4O/c1-9-3-6-13-10(14-9)12-5-2-7-15-8-4-11/h3,6H,2,4-5,7-8,11H2,1H3,(H,12,13,14) |
| InChIKey | IZEMMDGPQOOFSE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|