C12H23N5O — CID 106308253
N-[3-(2-aminoethoxy)propyl]-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 106308253) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 106308253 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCOCCN)nc1CC |
| InChI | InChI=1S/C12H23N5O/c1-3-10-11(4-2)16-17-12(15-10)14-7-5-8-18-9-6-13/h3-9,13H2,1-2H3,(H,14,15,17) |
| InChIKey | SYXBEHCKTCKFSG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|