C11H21N5 — CID 105362989
1-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1,3-diamine (PubChem CID 105362989) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1,3-diamine.
| Compound Name | 1-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 105362989 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 1-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1,3-diamine |
| SMILES | CCc1nnc(NCCC(C)N)nc1CC |
| InChI | InChI=1S/C11H21N5/c1-4-9-10(5-2)15-16-11(14-9)13-7-6-8(3)12/h8H,4-7,12H2,1-3H3,(H,13,14,16) |
| InChIKey | SQORFVLTCPDGQV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |