C9H15N5O — CID 105362361
2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]acetamide (PubChem CID 105362361) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]acetamide.
| Compound Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 105362361 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]acetamide |
| SMILES | CCc1nnc(NCC(N)=O)nc1CC |
| InChI | InChI=1S/C9H15N5O/c1-3-6-7(4-2)13-14-9(12-6)11-5-8(10)15/h3-5H2,1-2H3,(H2,10,15)(H,11,12,14) |
| InChIKey | GUUDMPFAKOKLJB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |