C9H15ClN4 — CID 105363386
N-(2-chloroethyl)-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 105363386) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(2-chloroethyl)-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105363386 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N-(2-chloroethyl)-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCl)nc1CC |
| InChI | InChI=1S/C9H15ClN4/c1-3-7-8(4-2)13-14-9(12-7)11-6-5-10/h3-6H2,1-2H3,(H,11,12,14) |
| InChIKey | ICAVBRGGKKUTJC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|