C14H25ClN4 — CID 114145656
N-[2-(2-chloroethyl)pentyl]-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 114145656) has the molecular formula C14H25ClN4 and a molecular weight of 284.83 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114145656 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCCC(CCCl)CNc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C14H25ClN4/c1-4-7-11(8-9-15)10-16-14-17-12(5-2)13(6-3)18-19-14/h11H,4-10H2,1-3H3,(H,16,17,19) |
| InChIKey | KJSSYFDKSSGBCU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|